Reaction name: Eawag BBD reaction r1795, Eawag BBD reaction r1790 Reaction description: no description Reaction smirks: C([C@@H]1[C@H]([C@@H](C(=O)CO1)O)O)O>>C1=C(C(=O)CO[C@@H]1CO)O The reaction has the following educts: Structure name: 1,5-Anhydro-D-fructose Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/f6303a92-f018-4c0b-9f66-eb9b56c0e0a7/structure/de2da4e9-d70e-48cd-85dd-15b201dd871a The reaction has the following products: Structure name: Ascopyrone M Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/577464cc-8795-4c14-9e99-8df55baef2f3/structure/0efbef2c-b5b6-4f54-ada5-2d4b4d4ef786 The reaction has the following scenarios: The reaction has no rule yet.