Reaction name: Eawag BBD reaction r1071 Reaction description: no description Reaction smirks: C1=C(C=C(C(=C1)[O-])[N+](=O)[O-])[N+](=O)[O-]>>C1=CC(=O)C(=[N+]([O-])[O-])CC1=[N+]([O-])[O-] The reaction has the following educts: Structure name: 2,4-Dinitrophenol Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/614fc1c7-955f-4baa-8f83-3e45a2f1b271/structure/ff67a360-ce01-4cf4-9079-7aed0b0a2515 The reaction has the following products: Structure name: 2,4-DNP Hydride Meisenheimer complex Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/4ca753e0-66a8-4b27-8a48-536274e7bfb5/structure/4a3075e4-51c6-451e-9e8e-59887c75cd5d The reaction has the following scenarios: The reaction has no rule yet.