Reaction name: Eawag BBD reaction r1017, Eawag BBD reaction r1016 Reaction description: no description Reaction smirks: C1=CC=C(C=C1)CSCC2=CC=CC=C2>>C1=CC=C(C=C1)CS(=O)CC2=CC=CC=C2 The reaction has the following educts: Structure name: Benzyl sulfide Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/393ec707-526b-4502-a1d0-ed3361163b91/structure/6a2c4598-8ba1-4275-87fd-197034d84188 The reaction has the following products: Structure name: Benzyl sulfoxide Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/7d654ac1-02fd-47de-a296-764dda851b6e/structure/b6f89ed2-d8b6-4d24-8f53-f9df971c8134 The reaction has the following scenarios: The reaction has the following rule: Rule name: bt0162-4180 Rule URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/simple-rule/fe9bb9f7-f1ef-4f9e-8eaa-0f7b84c2ff6b