Reaction name: Eawag BBD reaction r1499, Eawag BBD reaction r1498, Eawag BBD reaction r1359 Reaction description: no description Reaction smirks: C1=CC2=C(C=C1)C=C3C=CC=CC3=C2>>C1=CC2=C(C=C1)C(=O)C3=C(C=CC=C3)C2=O The reaction has the following educts: Structure name: Anthracene Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/b752b2af-8af4-4a26-8845-bf87b0eaf10f/structure/7b18b169-7d0a-4955-b59a-5e71275fbee0 The reaction has the following products: Structure name: 9,10-Anthraquinone Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/8fb6bf10-7eab-4edf-b036-c1e91397b684/structure/70e1292c-bd84-473d-b342-985651fc538e The reaction has the following scenarios: The reaction has no rule yet.