Reaction name: Eawag BBD reaction r1074 Reaction description: no description Reaction smirks: CC1C(O1)P(=O)(O)O>>C[C@H]([C@@H](P(=O)(O)O)SCC(C(=O)[O-])N)O The reaction has the following educts: Structure name: Hydrogen (2R,3S)-3-methyloxiran-2-ylphosphonic acid Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/ea0c2bee-f80d-416f-932c-834e0103dba3/structure/61216e7e-45ac-4a3b-b50c-8697f625fa32 The reaction has the following products: Structure name: Hydrogen (1R,2R)-1- L-cysteine-2-hydroxypropylphosphonic acid Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/993262a2-f76d-4e5d-b1e2-1df46aae0696/structure/1de25245-3b56-4878-867f-db822335559b The reaction has the following scenarios: The reaction has no rule yet.