Reaction name: Eawag BBD reaction r1070 Reaction description: no description Reaction smirks: C1C(=[N+]([O-])[O-])CC(=[N+]([O-])[O-])C(=O)C1=[N+]([O-])[O-]>>C1C(CC(=[N+]([O-])[O-])C(=O)C1=[N+]([O-])[O-])[N+](=O)[O-] The reaction has the following educts: Structure name: TNP Dihydride Meisenheimer complex (aci form) Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/6023249c-9416-4cbc-8056-833c70070a81/structure/5ee2517c-03e1-4e04-92cf-bdbc1259709c The reaction has the following products: Structure name: TNP Dihydride Meisenheimer complex (nitro form) Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/1511c23a-cc0b-4a97-a6ab-7662289bd436/structure/7374df1d-cd42-4b1c-b768-cf036a1aea63 The reaction has the following scenarios: The reaction has no rule yet.