Reaction name: Eawag BBD reaction r1066 Reaction description: no description Reaction smirks: C1=C(C(=O)C(=[N+]([O-])[O-])CC1=[N+]([O-])[O-])[N+](=O)[O-]>>C1C(=[N+]([O-])[O-])CC(=[N+]([O-])[O-])C(=O)C1=[N+]([O-])[O-] The reaction has the following educts: Structure name: TNP Hydride Meisenheimer complex Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/0b33b9ae-5082-48cd-8876-d5c30592107a/structure/6858332b-e88f-43d4-9ab9-2ff32e8a624b The reaction has the following products: Structure name: TNP Dihydride Meisenheimer complex (aci form) Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/6023249c-9416-4cbc-8056-833c70070a81/structure/5ee2517c-03e1-4e04-92cf-bdbc1259709c The reaction has the following scenarios: The reaction has no rule yet.