Reaction name: Eawag BBD reaction r0832 Reaction description: no description Reaction smirks: C(CC(=O)N[C@@H](CS[Se-])C(=O)NCC(=O)[O-])[C@@H](C(=O)[O-])N>>[SeH-] The reaction has the following educts: Structure name: Glutathionyl selenide anion Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/e7582bf3-f520-49e4-84bd-d1aee44d5ac7/structure/5fc3aa7e-94c9-4315-a5e7-502c29ad9dd0 The reaction has the following products: Structure name: Hydrogen Selenide Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/1e71e9cf-365f-47bc-a252-f0e75f597818/structure/f588ce9e-300a-4f17-b904-a93336260d87 The reaction has the following scenarios: The reaction has no rule yet.