Reaction name: Eawag BBD reaction r1065 Reaction description: no description Reaction smirks: C1=C(C(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])[O-])[N+](=O)[O-]>>C1=C(C(=O)C(=[N+]([O-])[O-])CC1=[N+]([O-])[O-])[N+](=O)[O-] The reaction has the following educts: Structure name: 2,4,6-Trinitrophenol Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/f0fc499c-5587-47e6-86a7-e59548d0b709/structure/26965486-8fad-441b-b2ef-b43b1382c172 The reaction has the following products: Structure name: TNP Hydride Meisenheimer complex Structure URI: https://envipath.org/package/32de3cf4-e3e6-4168-956e-32fa5ddb0ce1/compound/0b33b9ae-5082-48cd-8876-d5c30592107a/structure/6858332b-e88f-43d4-9ab9-2ff32e8a624b The reaction has the following scenarios: The reaction has no rule yet.